Compound Summary (CID 131365)
structure given in first source
Table of Contents Drug and Chemical Information: (Total:1)
Properties Computed from Structure:
Molecular Weight | 495.335241 [g/mol] | Molecular Formula | C15H22N5O12P | XLogP3-AA | -5.4 | H-Bond Donor | 8 | H-Bond Acceptor | 16 | Rotatable Bond Count | 7 | Tautomer Count | 6 | Exact Mass | 495.100258 | MonoIsotopic Mass | 495.100258 | Topological Polar Surface Area | 261 | Heavy Atom Count | 33 | Formal Charge | 0 | Complexity | 829 | Isotope Atom Count | 0 | Defined Atom StereoCenter Count | 8 | Undefined Atom StereoCenter Count | 0 | Defined Bond StereoCenter Count | 0 | Undefined Bond StereoCenter Count | 0 | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
IUPAC Name: [(2R,3S,4R,5S)-5-[(2R,3R,4R, 5R)-2-(2-amino-6-oxo-3H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3- yl]oxy-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate
Canonical SMILES: C1=NC2=C(N1C3C(C(C(O3)CO)O)OC4C(C(C(O4)COP(=O)(O)O)O)O)NC(=NC2=O)N
Isomeric SMILES: C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O[C@H]4[C@@H]([C@@H]([C@H] (O4)COP(=O)(O)O)O)O)NC(=NC2=O)N
InChI: InChI=1S/C15H22N5O12P/c16-15-18-11-6(12(25)19-15)17-3-20(11)13-10(8(23)4 (1-21)30-13)32-14-9(24)7(22)5(31-14)2-29-33(26,27)28/h3-5,7-10,13-14, 21-24H,1-2H2,(H2,26,27,28)(H3,16,18,19,25)/t4-,5-,7-,8-,9-,10-,13-, 14+/m1/s1
InChIKey: TVGUROHJABCRTB-MHJQXXNXSA-N
Compound Information:
Substance Information:
Substances: 3 Links
Category: [for same structure substances]
|
|
|
|
|
Compound ID | 131365 |
| Molecular Weight | 495.335241 [g/mol] |
| Molecular Formula | C15H22N5O12P |
| XLogP3-AA | -5.4 |
| H-Bond Donor | 8 |
| H-Bond Acceptor | 16 |
|
Links |
|