Maybridge4_003416 - Compound Summary (CID 100106)
![](../images/plus.gif) Table of Contents
BioActivity Results:
![](../images/top.gif)
Tested in BioAssays: All: 61 Inactive: 59 BioActivity Summary: This Compound with Similar Compounds![](../images/pcbioactivitys.gif)
AID: 1533 Source: PCMD Rml C and D inhibition 384-well mixture HTS from 1536-well compound plates
AID: 1531 Source: NMMLSC Multiplex HTS Assay for Inhibitors of MEK Kinase PB1 Domains, specifically MEK5 binding to MEK Kinase 2 Wildtype
AID: 1530 Source: NMMLSC Multiplex HTS Assay for Inhibitors of MEK Kinase PB1 Domains, specifically MEK5 MEK Kinase 2 mutant
AID: 1529 Source: NMMLSC Multiplex HTS Assay for Inhibitors of MEK Kinase PB1 Domains, specifically MEK5 MEK Kinase3 Wildtype
| more ...
Properties Computed from Structure:
![](../images/top.gif)
Molecular Weight | 337.36916 [g/mol] | Molecular Formula | C20H19NO4 | XLogP3-AA | 3.4 | H-Bond Donor | 1 | H-Bond Acceptor | 4 | Rotatable Bond Count | 4 | Exact Mass | 337.131408 | MonoIsotopic Mass | 337.131408 | Topological Polar Surface Area | 66.8 | Heavy Atom Count | 25 | Formal Charge | 0 | Complexity | 500 | Isotope Atom Count | 0 | Defined Atom StereoCenter Count | 0 | Undefined Atom StereoCenter Count | 1 | Defined Bond StereoCenter Count | 0 | Undefined Bond StereoCenter Count | 0 | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
![](../images/top.gif)
IUPAC Name: 1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid
Canonical SMILES: C1CC(N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O
InChI: InChI=1S/C20H19NO4/c22-19(23)18-10-5-11-21(18)20(24)25-12-17-15-8-3-1-6- 13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17-18H,5,10-12H2,(H,22,23)
InChIKey: ZPGDWQNBZYOZTI-UHFFFAOYSA-N
Compound Information:
![](../images/top.gif)
Substance Information:
![](../images/top.gif)
Substances:
All: 13 Links Same structure: 12 Links Mixture: 1 LinkCategory: [for same structure substances]
|
|
|
|
|
Compound ID | 100106 |
| Molecular Weight | 337.36916 [g/mol] |
| Molecular Formula | C20H19NO4 |
| XLogP3-AA | 3.4 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
|
![](http://pubchem.ncbi.nlm.nih.gov/images/6_6px.gif) ![](../images/plus.gif) Links |
|