5,6,7,8-tetrahydropteridine - Compound Summary (CID 156)
enzyme cofactor for certain oxidoreductases
  Table of Contents
 Drug and Chemical Information: (Total:1)
 Properties Computed from Structure:
| Molecular Weight | 136.15452 [g/mol] | | Molecular Formula | C6H8N4 | | XLogP3-AA | 0.3 | | H-Bond Donor | 2 | | H-Bond Acceptor | 4 | | Rotatable Bond Count | 0 | | Tautomer Count | 3 | | Exact Mass | 136.074896 | | MonoIsotopic Mass | 136.074896 | | Topological Polar Surface Area | 49.8 | | Heavy Atom Count | 10 | | Formal Charge | 0 | | Complexity | 116 | | Isotope Atom Count | 0 | | Defined Atom StereoCenter Count | 0 | | Undefined Atom StereoCenter Count | 0 | | Defined Bond StereoCenter Count | 0 | | Undefined Bond StereoCenter Count | 0 | | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
IUPAC Name: 5,6,7,8-tetrahydropteridine
Canonical SMILES: C1CNC2=NC=NC=C2N1
InChI: InChI=1S/C6H8N4/c1-2-9-6-5(8-1)3-7-4-10-6/h3-4,8H,1-2H2,(H,7,9,10)
InChIKey: IDAICLIJTRXNER-UHFFFAOYSA-N
Compound Information:
 Substance Information:
Substances: 9 Links
Category: [for same structure substances]
|
|
|
|
  | 
| Compound ID | 156 |
| | Molecular Weight | 136.15452 [g/mol] |
| | Molecular Formula | C6H8N4 |
| | XLogP3-AA | 0.3 |
| | H-Bond Donor | 2 |
| | H-Bond Acceptor | 4 |
|
 Links |
|
Literature
