Minocycline - Compound Summary (CID 5281021)
A TETRACYCLINE analog, having a 7-dimethylamino and lacking the 5 methyl and hydroxyl groups, which is effective against tetracycline-resistant STAPHYLOCOCCUS infections.
  Table of Contents
 Drug and Chemical Information: (Total:1)
Medication Information
ARESTIN (minocycline hydrochloride) Microspheres is a subgingival sustained-release product containing the antibiotic minocycline hydrochloride incorporated into a bioresorbable polymer, Poly (glycolide-co-dl-lactide) or PGLA, for  Minocycline hydrochloride, a semisynthetic derivative of tetracycline, is 4,7-Bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide monohydrochloride. The structural formula is Minocycline hydrochloride, a semisynthetic derivative of tetracycline, is 4,7-Bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide monohydrochloride. Its structural formula is: MINOCIN minocycline hydrochloride, is a semisynthetic derivative of tetracycline, 4,7-Bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide monohydrochloride.Its structural formula Minocycline hydrochloride is a semisynthetic derivative of tetracycline, 4,7-Bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide monohydrochloride. Its structural formula Minocycline hydrochloride, is a semisynthetic derivative of tetracycline, 4,7-Bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide monohydrochloride.Its structural formula is: Minocycline hydrochloride, is a semisynthetic derivative of tetracycline, 4,7-Bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide monohydrochloride.Its structural formula is:C Minocycline hydrochloride, a semisynthetic derivative of tetracycline, is [4S-(4,5a,12a)]-4,7- Bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2- naphthacenecarboxamide monohydrochloride. Its Minocycline hydrochloride, a semisynthetic derivative of tetracycline, is 4,7-Bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy- 1,11-dioxo-2-naphthacenecarboxamide monohydrochloride. Its structural formula is: Minocycline hydrochloride, a semi synthetic derivative of tetracycline, is [4S-(4,4a,5a,12a)]-4,7-Bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide mono hydrochloride. The Anti-Bacterial Agents
- Substances that reduce the growth or reproduction of BACTERIA. |
Pharmacological Classification Chemical ClassificationSafety and Toxicology
HSDB - Peer-reviewed summary of toxicity and biomedical effects | EINECS - European Inventory of Existing Commercial Chemical Substances | TOXLINE - Citations to the toxicological literature | TOXLINE - Citations to the toxicological literature | TOXLINE - Citations to the toxicological literature | LactMed - Information on chemicals that breastfeeding mothers may be exposed | ClinicalTrials.gov - Registry of federal and private clinical trials | ClinicalTrials.gov - Registry of federal and private clinical trials |
 Literature Choose by Subheadings:
Literature Keyword Mining Tool
 Properties Computed from Structure:
| Molecular Weight | 457.47638 [g/mol] | | Molecular Formula | C23H27N3O7 | | XLogP3 | 0 | | H-Bond Donor | 5 | | H-Bond Acceptor | 10 | | Rotatable Bond Count | 2 | | Tautomer Count | 288 | | Exact Mass | 457.1849 | | MonoIsotopic Mass | 457.1849 | | Topological Polar Surface Area | 165 | | Heavy Atom Count | 33 | | Formal Charge | 0 | | Complexity | 971 | | Isotope Atom Count | 0 | | Defined Atom StereoCenter Count | 4 | | Undefined Atom StereoCenter Count | 0 | | Defined Bond StereoCenter Count | 1 | | Undefined Bond StereoCenter Count | 0 | | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
IUPAC Name: (2Z,4S,4aS,5aR,12aS)-2-[amino(hydroxy)methylidene]-4, 7-bis(dimethylamino)-10,11,12a-trihydroxy-4a,5,5a, 6-tetrahydro-4H-tetracene-1,3,12-trione
Canonical SMILES: CN(C)C1C2CC3CC4=C(C=CC(=C4C(=C3C(=O)C2(C(=O)C(=C(N)O)C1=O)O)O)O)N(C)C
Isomeric SMILES: CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=CC(=C4C(=C3C(=O)[C@@]2(C(=O)/C(=C(/N)\ O)/C1=O)O)O)O)N(C)C
InChI: InChI=1S/C23H27N3O7/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19
(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28/h5-6,9,11,17,27-28,
32-33H,7-8,24H2,1-4H3/b22-16-/t9-,11-,17-,23-/m0/s1
InChIKey: CUJCFMVUUMIFDR-NNQQPRJISA-N
Compound Information:
 Substance Information:
Substances:
All: 75 Links Same structure: 16 Links Mixture: 59 LinksCategory: [for same structure substances]
|
|
|
|
  | 
| Compound ID | 5281021 |
| | Molecular Weight | 457.47638 [g/mol] |
| | Molecular Formula | C23H27N3O7 |
| | XLogP3 | 0 |
| | H-Bond Donor | 5 |
| | H-Bond Acceptor | 10 |
|
 Links |
|
