ribulose 5-phosphate - Substance Summary (SID 4335)
RN given refers to cpd without isomeric designation
  Table of Contents
 Drug and Chemical Information: (Total:1)
 Data Source: 
Depositor: KEGGExternal ID: C01101
 Properties Computed from Structure:
| Molecular Weight | 230.109801 [g/mol] | | Molecular Formula | C5H11O8P | | XLogP3-AA | -3.7 | | H-Bond Donor | 5 | | H-Bond Acceptor | 8 | | Rotatable Bond Count | 6 | | Tautomer Count | 8 | | Exact Mass | 230.019154 | | MonoIsotopic Mass | 230.019154 | | Topological Polar Surface Area | 145 | | Heavy Atom Count | 14 | | Formal Charge | 0 | | Complexity | 234 | | Isotope Atom Count | 0 | | Defined Atom StereoCenter Count | 2 | | Undefined Atom StereoCenter Count | 0 | | Defined Bond StereoCenter Count | 0 | | Undefined Bond StereoCenter Count | 0 | | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
IUPAC Name: [(2S,3S)-2,3,5-trihydroxy-4-oxopentyl] dihydrogen phosphate
Canonical SMILES: C(C(C(C(=O)CO)O)O)OP(=O)(O)O
Isomeric SMILES: C([C@@H]([C@@H](C(=O)CO)O)O)OP(=O)(O)O
InChI: InChI=1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h4-6,8-9H,1-2H2,(H2,
10,11,12)/t4-,5+/m0/s1
InChIKey: FNZLKVNUWIIPSJ-CRCLSJGQSA-N
Substance Information:
Depositor-Supplied Comments:
CAS: 4151-19-3
ChEBI: 17666
KNApSAcK: C00019543
3DMET: B01379
Is a reactant or product of enzyme EC 2.7.1.16
Is a reactant or product of enzyme EC 5.1.3.4
Is a reactant or product of enzyme EC 5.1.3.22
Is a reactant or product of enzyme EC 5.-.-.-
|
|
|
|
  |
| Compound ID | 439399 |
| | Molecular Weight | 230.109801 [g/mol] |
| | Molecular Formula | C5H11O8P |
| | XLogP3-AA | -3.7 |
| | H-Bond Donor | 5 |
| | H-Bond Acceptor | 8 |
|
 Links |
|
Literature
