5'-Guanylic Acid - Compound Summary (CID 6804)
Guanosine 5'-monophosphate. A guanine nucleotide containing one phosphate group esterified to the sugar moiety and found widely in nature.
  Table of Contents
 Drug and Chemical Information: (Total:2)
Display: Next 1 | All
 Properties Computed from Structure:
| Molecular Weight | 363.220621 [g/mol] | | Molecular Formula | C10H14N5O8P | | XLogP3 | -4.3 | | H-Bond Donor | 6 | | H-Bond Acceptor | 12 | | Rotatable Bond Count | 4 | | Tautomer Count | 6 | | Exact Mass | 363.057999 | | MonoIsotopic Mass | 363.057999 | | Topological Polar Surface Area | 202 | | Heavy Atom Count | 24 | | Formal Charge | 0 | | Complexity | 598 | | Isotope Atom Count | 0 | | Defined Atom StereoCenter Count | 4 | | Undefined Atom StereoCenter Count | 0 | | Defined Bond StereoCenter Count | 0 | | Undefined Bond StereoCenter Count | 0 | | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
IUPAC Name: [(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3, 4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate
Canonical SMILES: C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)O)O)O)NC(=NC2=O)N
Isomeric SMILES: C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)NC(=NC2=O)N
InChI: InChI=1S/C10H14N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3
(23-9)1-22-24(19,20)21/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,
18)/t3-,5-,6-,9-/m1/s1
InChIKey: RQFCJASXJCIDSX-UUOKFMHZSA-N
Compound Information:
 Substance Information:
Substances:
All: 120 Links Same structure: 68 Links Mixture: 52 LinksCategory: [for same structure substances]
|
|
|
|
  | 
| Compound ID | 6804 |
| | Molecular Weight | 363.220621 [g/mol] |
| | Molecular Formula | C10H14N5O8P |
| | XLogP3 | -4.3 |
| | H-Bond Donor | 6 |
| | H-Bond Acceptor | 12 |
|
 Links |
|
Literature
