narbomycin - Substance Summary (SID 14159)
structure![Link to MeSH](../images/meshs.gif)
![](../images/plus.gif) Table of Contents
Drug and Chemical Information: (Total:1)
![](../images/top.gif)
Data Source:
![](../images/top.gif)
Depositor: KEGGExternal ID: C11998
Properties Computed from Structure:
![](../images/top.gif)
Molecular Weight | 509.67528 [g/mol] | Molecular Formula | C28H47NO7 | XLogP3-AA | 4.4 | H-Bond Donor | 1 | H-Bond Acceptor | 8 | Rotatable Bond Count | 4 | Tautomer Count | 25 | Exact Mass | 509.335253 | MonoIsotopic Mass | 509.335253 | Topological Polar Surface Area | 102 | Heavy Atom Count | 36 | Formal Charge | 0 | Complexity | 797 | Isotope Atom Count | 0 | Defined Atom StereoCenter Count | 11 | Undefined Atom StereoCenter Count | 0 | Defined Bond StereoCenter Count | 1 | Undefined Bond StereoCenter Count | 0 | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
![](../images/top.gif)
IUPAC Name: (2R,5R,6R,7E,10R,12S,13S,14R)-13-[(2S,3R,4S, 6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-5-ethyl-2,6,10,12, 14-pentamethyl-4-oxacyclotetradec-7-ene-1,3,9-trione
Canonical SMILES: CCC1C(C=CC(=O)C(CC(C(C(C(=O)C(C(=O)O1)C)C)OC2C(C(CC(O2)C)N(C)C)O)C)C)C
Isomeric SMILES: CC[C@@H]1[C@@H](/C=C/C(=O)[C@@H](C[C@@H]([C@@H]([C@H](C(=O)[C@H](C(=O) O1)C)C)O[C@H]2[C@@H]([C@H](C[C@H](O2)C)N(C)C)O)C)C)C
InChI: InChI=1S/C28H47NO7/c1-10-23-15(2)11-12-22(30)16(3)13-17(4)26(19(6)24(31) 20(7)27(33)35-23)36-28-25(32)21(29(8)9)14-18(5)34-28/h11-12,15-21,23, 25-26,28,32H,10,13-14H2,1-9H3/b12-11+/t15-,16-,17+,18-,19+,20-,21+,23-, 25-,26+,28+/m1/s1
InChIKey: OXFYAOOMMKGGAI-JLTOUBQASA-N
Substance Information:
![](../images/top.gif)
Depositor-Supplied Comments:
![](../images/top.gif)
CAS: 6036-25-5
3DMET: B04404
|
|
|
|
|
Compound ID | 5282036 |
| Molecular Weight | 509.67528 [g/mol] |
| Molecular Formula | C28H47NO7 |
| XLogP3-AA | 4.4 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 8 |
|
![](http://pubchem.ncbi.nlm.nih.gov/images/6_6px.gif) ![](../images/plus.gif) Links |
|