Lactic Acid - Compound Summary (CID 107689)
A normal intermediate in the fermentation (oxidation, metabolism) of sugar. The concentrated form is used internally to prevent gastrointestinal fermentation. (From Stedman, 26th ed)
  Table of Contents
 Drug and Chemical Information: (Total:1)
Chemical ClassificationSafety and Toxicology
HSDB - Peer-reviewed summary of toxicity and biomedical effects | NIOSH ICSC - NIOSH International Chemical Safety Cards | CCRIS - Carcinogenicity, tumor promotion, tumor inhibition, and mutagenicity tests | EINECS - European Inventory of Existing Commercial Chemical Substances | Haz-Map - Occupational toxicology information | TOXLINE - Citations to the toxicological literature | NTP DBS - Toxicological assay results | Household Products - Information on household products containing a chemical |
 Literature Choose by Subheadings:
Literature Keyword Mining Tool
 Properties Computed from Structure:
| Molecular Weight | 90.07794 [g/mol] | | Molecular Formula | C3H6O3 | | XLogP3 | -0.7 | | H-Bond Donor | 2 | | H-Bond Acceptor | 3 | | Rotatable Bond Count | 1 | | Exact Mass | 90.031694 | | MonoIsotopic Mass | 90.031694 | | Topological Polar Surface Area | 57.5 | | Heavy Atom Count | 6 | | Formal Charge | 0 | | Complexity | 59.1 | | Isotope Atom Count | 0 | | Defined Atom StereoCenter Count | 1 | | Undefined Atom StereoCenter Count | 0 | | Defined Bond StereoCenter Count | 0 | | Undefined Bond StereoCenter Count | 0 | | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
IUPAC Name: (2S)-2-hydroxypropanoic acid
Canonical SMILES: CC(C(=O)O)O
Isomeric SMILES: C[C@@H](C(=O)O)O
InChI: InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1
InChIKey: JVTAAEKCZFNVCJ-REOHCLBHSA-N
Compound Information:
 Substance Information:
Substances:
All: 173 Links Same structure: 29 Links Mixture: 144 LinksCategory: [for same structure substances]
|
|
|
|
  | 
| Compound ID | 107689 |
| | Molecular Weight | 90.07794 [g/mol] |
| | Molecular Formula | C3H6O3 |
| | XLogP3 | -0.7 |
| | H-Bond Donor | 2 |
| | H-Bond Acceptor | 3 |
|
 Links |
|
