polystyrene sulfonic acid - Substance Summary (SID 17397422)
RN given refers to homopolymer with locant for ethenyl moiety in position 4; Ca salt is potassium absorbing resin administered orally for treatment of hyperkalemia
  Table of Contents
 Drug and Chemical Information: (Total:1)
Medication Information
KAYEXALATE, brand of sodium polystyrene sulfonate is a benzene, diethenyl-polymer, with ethenylbenzene, sulfonated, sodium salt and has the following structural formula:The drug is a cream to light brown finely ground, powdered form of  Kionex brand of sodium polystyrene sulfonate is a benzene, diethenyl- polymer with ethenylbenzene, sulfonated, sodium salt and has the following structural formula:The drug is a cream to light brown finely ground, powdered form of sodium Sodium Polystyrene Sulfonate Suspension, USP can be administered orally or in an enema and contains the following per 60 mL:sodium polystyrene sulfonate Safety and Toxicology
 Literature Literature Keyword Mining Tool
 Data Source: 
Depositor: KEGGExternal ID: D03270
 Properties Computed from Structure:
| Molecular Weight | 223.28238 [g/mol] | | Molecular Formula | C8H7CaO3S+ | | H-Bond Donor | 0 | | H-Bond Acceptor | 3 | | Rotatable Bond Count | 1 | | Exact Mass | 222.974181 | | MonoIsotopic Mass | 222.974181 | | Topological Polar Surface Area | 57.2 | | Heavy Atom Count | 13 | | Formal Charge | 1 | | Complexity | 237 | | Isotope Atom Count | 0 | | Defined Atom StereoCenter Count | 0 | | Undefined Atom StereoCenter Count | 0 | | Defined Bond StereoCenter Count | 0 | | Undefined Bond StereoCenter Count | 0 | | Covalently-Bonded Unit Count | 2 |
Descriptors Computed from Structure:
IUPAC Name: calcium 2-ethenylbenzenesulfonate
Canonical SMILES: C=CC1=CC=CC=C1S(=O)(=O)[O-].[Ca+2]
InChI: InChI=1S/C8H8O3S.Ca/c1-2-7-5-3-4-6-8(7)12(9,10)11;/h2-6H,1H2,(H,9,10,
11);/q;+2/p-1
InChIKey: IJBYVKWTVVYTPL-UHFFFAOYSA-M
Substance Information:
Depositor-Supplied Comments:
CAS: 37286-92-3
Therapeutic category: 2190
ATC code: V03AE01
Calcium salt of sulfonated styrene polymer
Deposited Substance chemical structure was generated via Synonym and MeSH to yield CID 169893
|
|
|
|
  |
 | Compound ID | 169893 |
| | Molecular Weight | 223.28238 [g/mol] |
| | Molecular Formula | C8H7CaO3S+ |
| | H-Bond Donor | 0 |
| | H-Bond Acceptor | 3 |
|
 Links |
|
Reason: 3D generation disallowed.