homocitric acid - Substance Summary (SID 4471)
Table of Contents Drug and Chemical Information: (Total:1)
Data Source:
Depositor: KEGGExternal ID: C01251
Properties Computed from Structure:
Molecular Weight | 206.1501 [g/mol] | Molecular Formula | C7H10O7 | XLogP3-AA | -1.7 | H-Bond Donor | 4 | H-Bond Acceptor | 7 | Rotatable Bond Count | 6 | Exact Mass | 206.042653 | MonoIsotopic Mass | 206.042653 | Topological Polar Surface Area | 132 | Heavy Atom Count | 14 | Formal Charge | 0 | Complexity | 259 | Isotope Atom Count | 0 | Defined Atom StereoCenter Count | 1 | Undefined Atom StereoCenter Count | 0 | Defined Bond StereoCenter Count | 0 | Undefined Bond StereoCenter Count | 0 | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
IUPAC Name: (2R)-2-hydroxybutane-1,2,4-tricarboxylic acid
Canonical SMILES: C(CC(CC(=O)O)(C(=O)O)O)C(=O)O
Isomeric SMILES: C(C[C@@](CC(=O)O)(C(=O)O)O)C(=O)O
InChI: InChI=1S/C7H10O7/c8-4(9)1-2-7(14,6(12)13)3-5(10)11/h14H,1-3H2,(H,8,9)(H, 10,11)(H,12,13)/t7-/m1/s1
InChIKey: XKJVEVRQMLKSMO-SSDOTTSWSA-N
Substance Information:
Depositor-Supplied Comments:
ChEBI: 17852
PDB-CCD: HCA
3DMET: B01423
Is a reactant or product of enzyme EC 1.18.6.1
Is a reactant or product of enzyme EC 2.3.3.14
Is a reactant or product of enzyme EC 4.2.1.36
|
|
|
|
|
Compound ID | 439459 |
| Molecular Weight | 206.1501 [g/mol] |
| Molecular Formula | C7H10O7 |
| XLogP3-AA | -1.7 |
| H-Bond Donor | 4 |
| H-Bond Acceptor | 7 |
|
Links |
|