Substance Summary (SID 7131)
Table of Contents Data Source:
Depositor: KEGGExternal ID: C04518
Properties Computed from Structure:
Molecular Weight | 332.47698 [g/mol] | Molecular Formula | C21H32O3 | XLogP3 | 2.5 | H-Bond Donor | 2 | H-Bond Acceptor | 3 | Rotatable Bond Count | 1 | Tautomer Count | 5 | Exact Mass | 332.235145 | MonoIsotopic Mass | 332.235145 | Topological Polar Surface Area | 57.5 | Heavy Atom Count | 24 | Formal Charge | 0 | Complexity | 596 | Isotope Atom Count | 0 | Defined Atom StereoCenter Count | 7 | Undefined Atom StereoCenter Count | 0 | Defined Bond StereoCenter Count | 0 | Undefined Bond StereoCenter Count | 0 | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
IUPAC Name: (8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(1S)-1-hydroxyethyl]-10, 13-dimethyl-2,6,7,8,9,11,12,14,15, 16-decahydro-1H-cyclopenta[a]phenanthren-3-one
Canonical SMILES: CC(C1(CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O)O
Isomeric SMILES: C[C@@H]([C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O)O
InChI: InChI=1S/C21H32O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14, 2)17(16)7-10-20(18,21)3/h12-13,16-18,22,24H,4-11H2,1-3H3/t13-,16+,17-, 18-,19-,20-,21-/m0/s1
InChIKey: MASCESDECGBIBB-HNXXTFFGSA-N
Substance Information:
Depositor-Supplied Comments:
CAS: 652-69-7
ChEBI: 16418
3DMET: B01751
Is a reactant or product of enzyme EC 1.1.1.149
|
|
|
|
|
Compound ID | 440368 |
| Molecular Weight | 332.47698 [g/mol] |
| Molecular Formula | C21H32O3 |
| XLogP3 | 2.5 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 3 |
|
Links |
|