beta-glucono-1,5-lactone - Compound Summary (CID 7027)
structure![Link to MeSH](../images/meshs.gif)
![](../images/plus.gif) Table of Contents
Drug and Chemical Information: (Total:1)
![](../images/top.gif)
Properties Computed from Structure:
![](../images/top.gif)
Molecular Weight | 178.14 [g/mol] | Molecular Formula | C6H10O6 | XLogP3-AA | -2 | H-Bond Donor | 4 | H-Bond Acceptor | 6 | Rotatable Bond Count | 1 | Exact Mass | 178.047738 | MonoIsotopic Mass | 178.047738 | Topological Polar Surface Area | 107 | Heavy Atom Count | 12 | Formal Charge | 0 | Complexity | 181 | Isotope Atom Count | 0 | Defined Atom StereoCenter Count | 4 | Undefined Atom StereoCenter Count | 0 | Defined Bond StereoCenter Count | 0 | Undefined Bond StereoCenter Count | 0 | Covalently-Bonded Unit Count | 1 |
Descriptors Computed from Structure:
![](../images/top.gif)
IUPAC Name: (3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-one
Canonical SMILES: C(C1C(C(C(C(=O)O1)O)O)O)O
Isomeric SMILES: C([C@@H]1[C@H]([C@@H]([C@H](C(=O)O1)O)O)O)O
InChI: InChI=1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+, 5-/m1/s1
InChIKey: PHOQVHQSTUBQQK-SQOUGZDYSA-N
Compound Information:
![](../images/top.gif)
Substance Information:
![](../images/top.gif)
Substances:
All: 33 Links Same structure: 26 Links Mixture: 7 LinksCategory: [for same structure substances]
|
|
|
|
|
Compound ID | 7027 |
| Molecular Weight | 178.14 [g/mol] |
| Molecular Formula | C6H10O6 |
| XLogP3-AA | -2 |
| H-Bond Donor | 4 |
| H-Bond Acceptor | 6 |
|
![](http://pubchem.ncbi.nlm.nih.gov/images/6_6px.gif) ![](../images/plus.gif) Links |
|